17-(2-chlorophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.0~2,7~.0~9,14~.0~15,19~]nonadeca-2,4,6,9,11,13-hexaene-1-carbaldehyde
Chemical Structure Depiction of
17-(2-chlorophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.0~2,7~.0~9,14~.0~15,19~]nonadeca-2,4,6,9,11,13-hexaene-1-carbaldehyde
17-(2-chlorophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.0~2,7~.0~9,14~.0~15,19~]nonadeca-2,4,6,9,11,13-hexaene-1-carbaldehyde
Compound characteristics
| Compound ID: | 3406-0567 |
| Compound Name: | 17-(2-chlorophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.0~2,7~.0~9,14~.0~15,19~]nonadeca-2,4,6,9,11,13-hexaene-1-carbaldehyde |
| Molecular Weight: | 413.86 |
| Molecular Formula: | C25 H16 Cl N O3 |
| Smiles: | C(C12C3C(C(c4ccccc14)c1ccccc12)C(N(C3=O)c1ccccc1[Cl])=O)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 3.6754 |
| logD: | 3.6752 |
| logSw: | -4.1164 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 42.308 |
| InChI Key: | FTDSEZIAMKBRFG-UHFFFAOYSA-N |