2-[6-chloro-2-(3-chlorophenyl)-4-phenylquinazolin-3(4H)-yl]acetohydrazide
Chemical Structure Depiction of
2-[6-chloro-2-(3-chlorophenyl)-4-phenylquinazolin-3(4H)-yl]acetohydrazide
2-[6-chloro-2-(3-chlorophenyl)-4-phenylquinazolin-3(4H)-yl]acetohydrazide
Compound characteristics
| Compound ID: | 3429-0008 |
| Compound Name: | 2-[6-chloro-2-(3-chlorophenyl)-4-phenylquinazolin-3(4H)-yl]acetohydrazide |
| Molecular Weight: | 425.32 |
| Molecular Formula: | C22 H18 Cl2 N4 O |
| Smiles: | C(C(NN)=O)N1C(c2ccccc2)c2cc(ccc2N=C1c1cccc(c1)[Cl])[Cl] |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.3566 |
| logD: | 1.1765 |
| logSw: | -4.6992 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 60.839 |
| InChI Key: | FXOYOUJHDNVDSW-NRFANRHFSA-N |