4-methyl-N-(6-methyl-2-oxo-4-phenyl-1,2-dihydroquinolin-3-yl)benzene-1-sulfonamide
Chemical Structure Depiction of
4-methyl-N-(6-methyl-2-oxo-4-phenyl-1,2-dihydroquinolin-3-yl)benzene-1-sulfonamide
4-methyl-N-(6-methyl-2-oxo-4-phenyl-1,2-dihydroquinolin-3-yl)benzene-1-sulfonamide
Compound characteristics
| Compound ID: | 3429-0058 |
| Compound Name: | 4-methyl-N-(6-methyl-2-oxo-4-phenyl-1,2-dihydroquinolin-3-yl)benzene-1-sulfonamide |
| Molecular Weight: | 404.49 |
| Molecular Formula: | C23 H20 N2 O3 S |
| Smiles: | Cc1ccc(cc1)S(NC1=C(c2ccccc2)c2cc(C)ccc2NC1=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.4966 |
| logD: | 1.7634 |
| logSw: | -4.2963 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 65.693 |
| InChI Key: | KBLCTPBNDWAFQQ-UHFFFAOYSA-N |