3-amino-1-[2-(trifluoromethyl)-10H-phenothiazin-10-yl]propan-1-one--hydrogen chloride (1/1)
Chemical Structure Depiction of
3-amino-1-[2-(trifluoromethyl)-10H-phenothiazin-10-yl]propan-1-one--hydrogen chloride (1/1)
3-amino-1-[2-(trifluoromethyl)-10H-phenothiazin-10-yl]propan-1-one--hydrogen chloride (1/1)
Compound characteristics
| Compound ID: | 3430-0003 |
| Compound Name: | 3-amino-1-[2-(trifluoromethyl)-10H-phenothiazin-10-yl]propan-1-one--hydrogen chloride (1/1) |
| Molecular Weight: | 374.81 |
| Molecular Formula: | C16 H13 F3 N2 O S |
| Salt: | HCl |
| Smiles: | C(CN)C(N1c2ccccc2Sc2ccc(cc12)C(F)(F)F)=O |
| Stereo: | ACHIRAL |
| logP: | 2.9131 |
| logD: | 2.1814 |
| logSw: | -3.5432 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 34.769 |
| InChI Key: | QVEUKHRUDUMXID-UHFFFAOYSA-N |