[4-(2-chloro-6-nitrophenyl)piperazin-1-yl](4-fluorophenyl)methanone
Chemical Structure Depiction of
[4-(2-chloro-6-nitrophenyl)piperazin-1-yl](4-fluorophenyl)methanone
[4-(2-chloro-6-nitrophenyl)piperazin-1-yl](4-fluorophenyl)methanone
Compound characteristics
| Compound ID: | 3448-5951 |
| Compound Name: | [4-(2-chloro-6-nitrophenyl)piperazin-1-yl](4-fluorophenyl)methanone |
| Molecular Weight: | 363.77 |
| Molecular Formula: | C17 H15 Cl F N3 O3 |
| Smiles: | C1CN(CCN1C(c1ccc(cc1)F)=O)c1c(cccc1[Cl])[N+]([O-])=O |
| Stereo: | ACHIRAL |
| logP: | 3.2691 |
| logD: | 3.2691 |
| logSw: | -3.663 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 52.626 |
| InChI Key: | MYBOVLBHVBEKBL-UHFFFAOYSA-N |