N-phenyl-4,6-bis(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-amine
Chemical Structure Depiction of
N-phenyl-4,6-bis(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-amine
N-phenyl-4,6-bis(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-amine
Compound characteristics
| Compound ID: | 3448-7727 |
| Compound Name: | N-phenyl-4,6-bis(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-amine |
| Molecular Weight: | 368.24 |
| Molecular Formula: | C13 H10 F6 N4 O2 |
| Smiles: | C(C(F)(F)F)Oc1nc(Nc2ccccc2)nc(n1)OCC(F)(F)F |
| Stereo: | ACHIRAL |
| logP: | 4.8161 |
| logD: | 4.8161 |
| logSw: | -4.855 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 54.751 |
| InChI Key: | AWOJCDUNKBQLQT-UHFFFAOYSA-N |