3-(2,5-dimethoxyphenyl)-2-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]prop-2-enenitrile
Chemical Structure Depiction of
3-(2,5-dimethoxyphenyl)-2-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]prop-2-enenitrile
3-(2,5-dimethoxyphenyl)-2-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]prop-2-enenitrile
Compound characteristics
| Compound ID: | 3448-7799 |
| Compound Name: | 3-(2,5-dimethoxyphenyl)-2-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]prop-2-enenitrile |
| Molecular Weight: | 366.41 |
| Molecular Formula: | C20 H15 F N2 O2 S |
| Smiles: | COc1ccc(c(\C=C(/C#N)c2nc(cs2)c2ccc(cc2)F)c1)OC |
| Stereo: | ACHIRAL |
| logP: | 5.526 |
| logD: | 5.526 |
| logSw: | -5.6188 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 41.931 |
| InChI Key: | SSVWBWFUAAUVSF-UHFFFAOYSA-N |