methyl 2-(morpholin-4-yl)-5-nitrobenzoate
Chemical Structure Depiction of
methyl 2-(morpholin-4-yl)-5-nitrobenzoate
methyl 2-(morpholin-4-yl)-5-nitrobenzoate
Compound characteristics
| Compound ID: | 3448-9292 |
| Compound Name: | methyl 2-(morpholin-4-yl)-5-nitrobenzoate |
| Molecular Weight: | 266.25 |
| Molecular Formula: | C12 H14 N2 O5 |
| Smiles: | COC(c1cc(ccc1N1CCOCC1)[N+]([O-])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.739 |
| logD: | 1.739 |
| logSw: | -2.3635 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 65.854 |
| InChI Key: | QVXVAXLVFPLUDM-UHFFFAOYSA-N |