methyl {5-[(furan-2-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl}acetate
Chemical Structure Depiction of
methyl {5-[(furan-2-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl}acetate
methyl {5-[(furan-2-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl}acetate
Compound characteristics
| Compound ID: | 3453-1652 |
| Compound Name: | methyl {5-[(furan-2-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl}acetate |
| Molecular Weight: | 283.32 |
| Molecular Formula: | C11 H9 N O4 S2 |
| Smiles: | COC(CN1C(/C(=C\c2ccco2)SC1=S)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.5664 |
| logD: | 1.5664 |
| logSw: | -2.1212 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 45.042 |
| InChI Key: | UPFZYXWYLMXCDM-UHFFFAOYSA-N |