5-[(5-bromo-2-hydroxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one
Chemical Structure Depiction of
5-[(5-bromo-2-hydroxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one
5-[(5-bromo-2-hydroxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one
Compound characteristics
| Compound ID: | 3454-0262 |
| Compound Name: | 5-[(5-bromo-2-hydroxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| Molecular Weight: | 316.19 |
| Molecular Formula: | C10 H6 Br N O2 S2 |
| Smiles: | C(=C1/C(NC(=S)S1)=O)/c1cc(ccc1O)[Br] |
| Stereo: | ACHIRAL |
| logP: | 2.2656 |
| logD: | 1.1992 |
| logSw: | -2.7938 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 41.448 |
| InChI Key: | ARKQCBSGSQCIEZ-UHFFFAOYSA-N |