2-(methoxymethyl)-1-methyl-5-nitro-3-phenyl-1H-indole
Chemical Structure Depiction of
2-(methoxymethyl)-1-methyl-5-nitro-3-phenyl-1H-indole
2-(methoxymethyl)-1-methyl-5-nitro-3-phenyl-1H-indole
Compound characteristics
| Compound ID: | 3455-0857 |
| Compound Name: | 2-(methoxymethyl)-1-methyl-5-nitro-3-phenyl-1H-indole |
| Molecular Weight: | 296.32 |
| Molecular Formula: | C17 H16 N2 O3 |
| Smiles: | Cn1c(COC)c(c2ccccc2)c2cc(ccc12)[N+]([O-])=O |
| Stereo: | ACHIRAL |
| logP: | 3.7202 |
| logD: | 3.7202 |
| logSw: | -4.309 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 43.565 |
| InChI Key: | XIGFCTDYKQUJCT-UHFFFAOYSA-N |