ethyl 2-cyano-3-(2,2-dimethyloxan-4-yl)-3-(4-fluorophenyl)propanoate
					Chemical Structure Depiction of
ethyl 2-cyano-3-(2,2-dimethyloxan-4-yl)-3-(4-fluorophenyl)propanoate
			ethyl 2-cyano-3-(2,2-dimethyloxan-4-yl)-3-(4-fluorophenyl)propanoate
Compound characteristics
| Compound ID: | 3456-0162 | 
| Compound Name: | ethyl 2-cyano-3-(2,2-dimethyloxan-4-yl)-3-(4-fluorophenyl)propanoate | 
| Molecular Weight: | 333.4 | 
| Molecular Formula: | C19 H24 F N O3 | 
| Smiles: | CCOC(C(C#N)C(C1CCOC(C)(C)C1)c1ccc(cc1)F)=O | 
| Stereo: | MIXTURE OF STEREOISOMERS | 
| logP: | 3.5135 | 
| logD: | 3.5135 | 
| logSw: | -3.5546 | 
| Hydrogen bond acceptors count: | 5 | 
| Polar surface area: | 45.168 | 
| InChI Key: | RXKQWQWAWGCAQF-UHFFFAOYSA-N | 
 
				 
				