N-[3-(2,2-dimethyloxan-4-yl)-3-phenylpropyl]-N-[(4-methoxyphenyl)methyl]acetamide
Chemical Structure Depiction of
N-[3-(2,2-dimethyloxan-4-yl)-3-phenylpropyl]-N-[(4-methoxyphenyl)methyl]acetamide
N-[3-(2,2-dimethyloxan-4-yl)-3-phenylpropyl]-N-[(4-methoxyphenyl)methyl]acetamide
Compound characteristics
| Compound ID: | 3456-0195 |
| Compound Name: | N-[3-(2,2-dimethyloxan-4-yl)-3-phenylpropyl]-N-[(4-methoxyphenyl)methyl]acetamide |
| Molecular Weight: | 409.57 |
| Molecular Formula: | C26 H35 N O3 |
| Smiles: | CC(N(CCC(C1CCOC(C)(C)C1)c1ccccc1)Cc1ccc(cc1)OC)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 4.895 |
| logD: | 4.895 |
| logSw: | -4.5312 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 31.559 |
| InChI Key: | RRHDZAPINIYECO-UHFFFAOYSA-N |