ethyl 5-[(2-methoxyphenyl)carbamoyl]-4-methyl-2-[(thiophene-2-carbonyl)amino]thiophene-3-carboxylate
Chemical Structure Depiction of
ethyl 5-[(2-methoxyphenyl)carbamoyl]-4-methyl-2-[(thiophene-2-carbonyl)amino]thiophene-3-carboxylate
ethyl 5-[(2-methoxyphenyl)carbamoyl]-4-methyl-2-[(thiophene-2-carbonyl)amino]thiophene-3-carboxylate
Compound characteristics
| Compound ID: | 3490-5475 |
| Compound Name: | ethyl 5-[(2-methoxyphenyl)carbamoyl]-4-methyl-2-[(thiophene-2-carbonyl)amino]thiophene-3-carboxylate |
| Molecular Weight: | 444.53 |
| Molecular Formula: | C21 H20 N2 O5 S2 |
| Smiles: | CCOC(c1c(C)c(C(Nc2ccccc2OC)=O)sc1NC(c1cccs1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.1136 |
| logD: | 0.6103 |
| logSw: | -4.3893 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 74.92 |
| InChI Key: | WMNIENXMSPAMIO-UHFFFAOYSA-N |