5-phenyl-2-({[2-(piperazin-1-yl)ethyl]amino}methylidene)cyclohexane-1,3-dione
Chemical Structure Depiction of
5-phenyl-2-({[2-(piperazin-1-yl)ethyl]amino}methylidene)cyclohexane-1,3-dione
5-phenyl-2-({[2-(piperazin-1-yl)ethyl]amino}methylidene)cyclohexane-1,3-dione
Compound characteristics
| Compound ID: | 3533-0146 |
| Compound Name: | 5-phenyl-2-({[2-(piperazin-1-yl)ethyl]amino}methylidene)cyclohexane-1,3-dione |
| Molecular Weight: | 327.42 |
| Molecular Formula: | C19 H25 N3 O2 |
| Smiles: | C1C(CC(C(=CNCCN2CCNCC2)C1=O)=O)c1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 0.8889 |
| logD: | -0.5631 |
| logSw: | -1.5323 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 55.3 |
| InChI Key: | WOCWRBCGPWPIKN-UHFFFAOYSA-N |