2-[(2-ethoxyanilino)methylidene]-5-phenylcyclohexane-1,3-dione
Chemical Structure Depiction of
2-[(2-ethoxyanilino)methylidene]-5-phenylcyclohexane-1,3-dione
2-[(2-ethoxyanilino)methylidene]-5-phenylcyclohexane-1,3-dione
Compound characteristics
| Compound ID: | 3533-0183 |
| Compound Name: | 2-[(2-ethoxyanilino)methylidene]-5-phenylcyclohexane-1,3-dione |
| Molecular Weight: | 335.4 |
| Molecular Formula: | C21 H21 N O3 |
| Smiles: | CCOc1ccccc1NC=C1C(CC(CC1=O)c1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.1417 |
| logD: | 3.9408 |
| logSw: | -4.2339 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 44.497 |
| InChI Key: | RTMHMHALQMNAFR-UHFFFAOYSA-N |