N,4-bis(4-chlorophenyl)-2,2,4-trimethyl-3,4-dihydroquinoline-1(2H)-carboxamide
Chemical Structure Depiction of
N,4-bis(4-chlorophenyl)-2,2,4-trimethyl-3,4-dihydroquinoline-1(2H)-carboxamide
N,4-bis(4-chlorophenyl)-2,2,4-trimethyl-3,4-dihydroquinoline-1(2H)-carboxamide
Compound characteristics
| Compound ID: | 3535-0281 |
| Compound Name: | N,4-bis(4-chlorophenyl)-2,2,4-trimethyl-3,4-dihydroquinoline-1(2H)-carboxamide |
| Molecular Weight: | 439.38 |
| Molecular Formula: | C25 H24 Cl2 N2 O |
| Smiles: | CC1(CC(C)(C)N(C(Nc2ccc(cc2)[Cl])=O)c2ccccc12)c1ccc(cc1)[Cl] |
| Stereo: | RACEMIC MIXTURE |
| logP: | 7.0513 |
| logD: | 7.0513 |
| logSw: | -6.2315 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 22.8733 |
| InChI Key: | UXWSWCFDFDSZMC-VWLOTQADSA-N |