5-{[5-(2-methoxy-5-nitrophenyl)furan-2-yl]methylidene}-2-sulfanylidene-1,3-thiazolidin-4-one
Chemical Structure Depiction of
5-{[5-(2-methoxy-5-nitrophenyl)furan-2-yl]methylidene}-2-sulfanylidene-1,3-thiazolidin-4-one
5-{[5-(2-methoxy-5-nitrophenyl)furan-2-yl]methylidene}-2-sulfanylidene-1,3-thiazolidin-4-one
Compound characteristics
| Compound ID: | 3559-3536 |
| Compound Name: | 5-{[5-(2-methoxy-5-nitrophenyl)furan-2-yl]methylidene}-2-sulfanylidene-1,3-thiazolidin-4-one |
| Molecular Weight: | 362.38 |
| Molecular Formula: | C15 H10 N2 O5 S2 |
| Smiles: | COc1ccc(cc1c1ccc(/C=C2/C(NC(=S)S2)=O)o1)[N+]([O-])=O |
| Stereo: | ACHIRAL |
| logP: | 2.61 |
| logD: | 1.2184 |
| logSw: | -3.339 |
| Hydrogen bond acceptors count: | 11 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 73.482 |
| InChI Key: | BIGONBPUJRNZQC-UHFFFAOYSA-N |