5-({3-[(4-chlorophenyl)methoxy]phenyl}methylidene)-2-sulfanylidene-1,3-thiazolidin-4-one
Chemical Structure Depiction of
5-({3-[(4-chlorophenyl)methoxy]phenyl}methylidene)-2-sulfanylidene-1,3-thiazolidin-4-one
5-({3-[(4-chlorophenyl)methoxy]phenyl}methylidene)-2-sulfanylidene-1,3-thiazolidin-4-one
Compound characteristics
| Compound ID: | 3559-3567 |
| Compound Name: | 5-({3-[(4-chlorophenyl)methoxy]phenyl}methylidene)-2-sulfanylidene-1,3-thiazolidin-4-one |
| Molecular Weight: | 361.87 |
| Molecular Formula: | C17 H12 Cl N O2 S2 |
| Smiles: | C(c1ccc(cc1)[Cl])Oc1cccc(/C=C2/C(NC(=S)S2)=O)c1 |
| Stereo: | ACHIRAL |
| logP: | 3.6507 |
| logD: | 2.2995 |
| logSw: | -4.1826 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 32.128 |
| InChI Key: | NEADTIRNSNHZOL-UHFFFAOYSA-N |