4-bromo-N-(3-methoxyphenyl)-1-methyl-1H-pyrazole-3-carboxamide
Chemical Structure Depiction of
4-bromo-N-(3-methoxyphenyl)-1-methyl-1H-pyrazole-3-carboxamide
4-bromo-N-(3-methoxyphenyl)-1-methyl-1H-pyrazole-3-carboxamide
Compound characteristics
| Compound ID: | 3567-0565 |
| Compound Name: | 4-bromo-N-(3-methoxyphenyl)-1-methyl-1H-pyrazole-3-carboxamide |
| Molecular Weight: | 310.15 |
| Molecular Formula: | C12 H12 Br N3 O2 |
| Smiles: | Cn1cc(c(C(Nc2cccc(c2)OC)=O)n1)[Br] |
| Stereo: | ACHIRAL |
| logP: | 2.1868 |
| logD: | 2.186 |
| logSw: | -2.91 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 46.229 |
| InChI Key: | NAVYJKQZNPZIKY-UHFFFAOYSA-N |