ethyl 6-bromo-5-(2-tert-butoxy-2-oxoethoxy)-2-methyl-1-benzofuran-3-carboxylate
Chemical Structure Depiction of
ethyl 6-bromo-5-(2-tert-butoxy-2-oxoethoxy)-2-methyl-1-benzofuran-3-carboxylate
ethyl 6-bromo-5-(2-tert-butoxy-2-oxoethoxy)-2-methyl-1-benzofuran-3-carboxylate
Compound characteristics
| Compound ID: | 3570-0711 |
| Compound Name: | ethyl 6-bromo-5-(2-tert-butoxy-2-oxoethoxy)-2-methyl-1-benzofuran-3-carboxylate |
| Molecular Weight: | 413.26 |
| Molecular Formula: | C18 H21 Br O6 |
| Smiles: | CCOC(c1c2cc(c(cc2oc1C)[Br])OCC(=O)OC(C)(C)C)=O |
| Stereo: | ACHIRAL |
| logP: | 4.3912 |
| logD: | 4.3912 |
| logSw: | -4.5238 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 55.793 |
| InChI Key: | OXPQDUXJHDHIQV-UHFFFAOYSA-N |