ethyl 5-[(3-bromophenyl)methoxy]-2-methyl-1-benzofuran-3-carboxylate
Chemical Structure Depiction of
ethyl 5-[(3-bromophenyl)methoxy]-2-methyl-1-benzofuran-3-carboxylate
ethyl 5-[(3-bromophenyl)methoxy]-2-methyl-1-benzofuran-3-carboxylate
Compound characteristics
| Compound ID: | 3570-0725 |
| Compound Name: | ethyl 5-[(3-bromophenyl)methoxy]-2-methyl-1-benzofuran-3-carboxylate |
| Molecular Weight: | 389.24 |
| Molecular Formula: | C19 H17 Br O4 |
| Smiles: | CCOC(c1c2cc(ccc2oc1C)OCc1cccc(c1)[Br])=O |
| Stereo: | ACHIRAL |
| logP: | 5.2263 |
| logD: | 5.2263 |
| logSw: | -5.3836 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 36.167 |
| InChI Key: | XBSKPWSXKFJSEZ-UHFFFAOYSA-N |