5-{[2-(benzyloxy)-5-chlorophenyl]methylidene}-2-sulfanylidene-1,3-thiazolidin-4-one
Chemical Structure Depiction of
5-{[2-(benzyloxy)-5-chlorophenyl]methylidene}-2-sulfanylidene-1,3-thiazolidin-4-one
5-{[2-(benzyloxy)-5-chlorophenyl]methylidene}-2-sulfanylidene-1,3-thiazolidin-4-one
Compound characteristics
| Compound ID: | 3584-0165 |
| Compound Name: | 5-{[2-(benzyloxy)-5-chlorophenyl]methylidene}-2-sulfanylidene-1,3-thiazolidin-4-one |
| Molecular Weight: | 361.87 |
| Molecular Formula: | C17 H12 Cl N O2 S2 |
| Smiles: | C(c1ccccc1)Oc1ccc(cc1/C=C1/C(NC(=S)S1)=O)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 4.1177 |
| logD: | 3.0513 |
| logSw: | -4.58 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 32.214 |
| InChI Key: | KPEZRKHEYGCWDW-UHFFFAOYSA-N |