5-({3-chloro-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl}methylidene)-2-sulfanylidene-1,3-thiazolidin-4-one
Chemical Structure Depiction of
5-({3-chloro-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl}methylidene)-2-sulfanylidene-1,3-thiazolidin-4-one
5-({3-chloro-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl}methylidene)-2-sulfanylidene-1,3-thiazolidin-4-one
Compound characteristics
| Compound ID: | 3584-0419 |
| Compound Name: | 5-({3-chloro-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl}methylidene)-2-sulfanylidene-1,3-thiazolidin-4-one |
| Molecular Weight: | 409.88 |
| Molecular Formula: | C18 H13 Cl F N O3 S2 |
| Smiles: | COc1cc(\C=C2/C(NC(=S)S2)=O)cc(c1OCc1ccc(cc1)F)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 3.8932 |
| logD: | 2.542 |
| logSw: | -4.2596 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 39.931 |
| InChI Key: | SZWMQQDHKCDUBT-UHFFFAOYSA-N |