5-({3-iodo-5-methoxy-4-[2-(3-methoxyphenoxy)ethoxy]phenyl}methylidene)-3-methyl-2-sulfanylidene-1,3-thiazolidin-4-one
Chemical Structure Depiction of
5-({3-iodo-5-methoxy-4-[2-(3-methoxyphenoxy)ethoxy]phenyl}methylidene)-3-methyl-2-sulfanylidene-1,3-thiazolidin-4-one
5-({3-iodo-5-methoxy-4-[2-(3-methoxyphenoxy)ethoxy]phenyl}methylidene)-3-methyl-2-sulfanylidene-1,3-thiazolidin-4-one
Compound characteristics
| Compound ID: | 3584-2450 |
| Compound Name: | 5-({3-iodo-5-methoxy-4-[2-(3-methoxyphenoxy)ethoxy]phenyl}methylidene)-3-methyl-2-sulfanylidene-1,3-thiazolidin-4-one |
| Molecular Weight: | 557.42 |
| Molecular Formula: | C21 H20 I N O5 S2 |
| Smiles: | CN1C(/C(=C\c2cc(c(c(c2)I)OCCOc2cccc(c2)OC)OC)SC1=S)=O |
| Stereo: | ACHIRAL |
| logP: | 4.6818 |
| logD: | 4.6818 |
| logSw: | -4.5406 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 46.391 |
| InChI Key: | LVAMJYVZXIHXIV-UHFFFAOYSA-N |