5-amino-3-[1-cyano-2-(2,3-difluorophenyl)ethenyl]-1-phenyl-1H-pyrazole-4-carbonitrile
Chemical Structure Depiction of
5-amino-3-[1-cyano-2-(2,3-difluorophenyl)ethenyl]-1-phenyl-1H-pyrazole-4-carbonitrile
5-amino-3-[1-cyano-2-(2,3-difluorophenyl)ethenyl]-1-phenyl-1H-pyrazole-4-carbonitrile
Compound characteristics
| Compound ID: | 3601-0179 |
| Compound Name: | 5-amino-3-[1-cyano-2-(2,3-difluorophenyl)ethenyl]-1-phenyl-1H-pyrazole-4-carbonitrile |
| Molecular Weight: | 347.32 |
| Molecular Formula: | C19 H11 F2 N5 |
| Smiles: | C(=C(C#N)/c1c(C#N)c(N)n(c2ccccc2)n1)\c1cccc(c1F)F |
| Stereo: | ACHIRAL |
| logP: | 3.3951 |
| logD: | 3.3951 |
| logSw: | -3.7785 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 67.942 |
| InChI Key: | SLWNFLYVFYLUTF-UHFFFAOYSA-N |