2-chloro-6-ethoxy-4-{[3-methyl-2-(methylimino)-4-oxo-1,3-thiazolidin-5-ylidene]methyl}phenyl acetate
Chemical Structure Depiction of
2-chloro-6-ethoxy-4-{[3-methyl-2-(methylimino)-4-oxo-1,3-thiazolidin-5-ylidene]methyl}phenyl acetate
2-chloro-6-ethoxy-4-{[3-methyl-2-(methylimino)-4-oxo-1,3-thiazolidin-5-ylidene]methyl}phenyl acetate
Compound characteristics
| Compound ID: | 3601-0246 |
| Compound Name: | 2-chloro-6-ethoxy-4-{[3-methyl-2-(methylimino)-4-oxo-1,3-thiazolidin-5-ylidene]methyl}phenyl acetate |
| Molecular Weight: | 368.84 |
| Molecular Formula: | C16 H17 Cl N2 O4 S |
| Smiles: | CCOc1cc(/C=C2/C(N(C)\C(=N/C)S2)=O)cc(c1OC(C)=O)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 3.0896 |
| logD: | 3.0896 |
| logSw: | -3.6474 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 56.061 |
| InChI Key: | UWBUAWPATGEYEG-UHFFFAOYSA-N |