1-[4-(4-chloro-2-nitrophenyl)piperazin-1-yl]-2-(4-chlorophenyl)ethan-1-one
Chemical Structure Depiction of
1-[4-(4-chloro-2-nitrophenyl)piperazin-1-yl]-2-(4-chlorophenyl)ethan-1-one
1-[4-(4-chloro-2-nitrophenyl)piperazin-1-yl]-2-(4-chlorophenyl)ethan-1-one
Compound characteristics
| Compound ID: | 3616-1701 |
| Compound Name: | 1-[4-(4-chloro-2-nitrophenyl)piperazin-1-yl]-2-(4-chlorophenyl)ethan-1-one |
| Molecular Weight: | 394.26 |
| Molecular Formula: | C18 H17 Cl2 N3 O3 |
| Smiles: | C(C(N1CCN(CC1)c1ccc(cc1[N+]([O-])=O)[Cl])=O)c1ccc(cc1)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 4.1249 |
| logD: | 4.1249 |
| logSw: | -4.5244 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 52.399 |
| InChI Key: | VDJUMGHYNHGWNM-UHFFFAOYSA-N |