(3-chloro-1-benzothiophen-2-yl)[4-(4-nitrophenyl)piperazin-1-yl]methanone
Chemical Structure Depiction of
(3-chloro-1-benzothiophen-2-yl)[4-(4-nitrophenyl)piperazin-1-yl]methanone
(3-chloro-1-benzothiophen-2-yl)[4-(4-nitrophenyl)piperazin-1-yl]methanone
Compound characteristics
| Compound ID: | 3616-1880 |
| Compound Name: | (3-chloro-1-benzothiophen-2-yl)[4-(4-nitrophenyl)piperazin-1-yl]methanone |
| Molecular Weight: | 401.87 |
| Molecular Formula: | C19 H16 Cl N3 O3 S |
| Smiles: | C1CN(CCN1C(c1c(c2ccccc2s1)[Cl])=O)c1ccc(cc1)[N+]([O-])=O |
| Stereo: | ACHIRAL |
| logP: | 4.7382 |
| logD: | 4.7382 |
| logSw: | -4.9743 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 54.275 |
| InChI Key: | KRGZPYONZRAXLJ-UHFFFAOYSA-N |