5-{[4-(2-methylpropoxy)phenyl]methylidene}-2-sulfanylideneimidazolidin-4-one
Chemical Structure Depiction of
5-{[4-(2-methylpropoxy)phenyl]methylidene}-2-sulfanylideneimidazolidin-4-one
5-{[4-(2-methylpropoxy)phenyl]methylidene}-2-sulfanylideneimidazolidin-4-one
Compound characteristics
| Compound ID: | 3619-0014 |
| Compound Name: | 5-{[4-(2-methylpropoxy)phenyl]methylidene}-2-sulfanylideneimidazolidin-4-one |
| Molecular Weight: | 276.35 |
| Molecular Formula: | C14 H16 N2 O2 S |
| Smiles: | CC(C)COc1ccc(/C=C2/C(NC(N2)=S)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 3.0083 |
| logD: | 2.9875 |
| logSw: | -3.4647 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 43.793 |
| InChI Key: | UKBLFOPQVVYIDD-UHFFFAOYSA-N |