5-[(3-bromo-5-methoxy-4-propoxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione
Chemical Structure Depiction of
5-[(3-bromo-5-methoxy-4-propoxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione
5-[(3-bromo-5-methoxy-4-propoxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione
Compound characteristics
| Compound ID: | 3620-0133 |
| Compound Name: | 5-[(3-bromo-5-methoxy-4-propoxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione |
| Molecular Weight: | 383.2 |
| Molecular Formula: | C15 H15 Br N2 O5 |
| Smiles: | CCCOc1c(cc(C=C2C(NC(NC2=O)=O)=O)cc1[Br])OC |
| Stereo: | ACHIRAL |
| logP: | 2.3027 |
| logD: | 1.9555 |
| logSw: | -2.8437 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 77.865 |
| InChI Key: | YZJNVYRIOPBMDQ-UHFFFAOYSA-N |