3-(3,4-dimethoxyphenyl)-2-(4-oxo-3,4-dihydroquinazolin-2-yl)prop-2-enenitrile
Chemical Structure Depiction of
3-(3,4-dimethoxyphenyl)-2-(4-oxo-3,4-dihydroquinazolin-2-yl)prop-2-enenitrile
3-(3,4-dimethoxyphenyl)-2-(4-oxo-3,4-dihydroquinazolin-2-yl)prop-2-enenitrile
Compound characteristics
| Compound ID: | 3643-1633 |
| Compound Name: | 3-(3,4-dimethoxyphenyl)-2-(4-oxo-3,4-dihydroquinazolin-2-yl)prop-2-enenitrile |
| Molecular Weight: | 333.34 |
| Molecular Formula: | C19 H15 N3 O3 |
| Smiles: | COc1ccc(/C=C(C#N)/C2NC(c3ccccc3N=2)=O)cc1OC |
| Stereo: | ACHIRAL |
| logP: | 2.1163 |
| logD: | 0.7703 |
| logSw: | -3.1837 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 67.208 |
| InChI Key: | VVOFKYNQZAOBSB-UHFFFAOYSA-N |