ethyl 4-(3-methylanilino)quinoline-3-carboxylate
Chemical Structure Depiction of
ethyl 4-(3-methylanilino)quinoline-3-carboxylate
ethyl 4-(3-methylanilino)quinoline-3-carboxylate
Compound characteristics
| Compound ID: | 3643-2578 |
| Compound Name: | ethyl 4-(3-methylanilino)quinoline-3-carboxylate |
| Molecular Weight: | 306.36 |
| Molecular Formula: | C19 H18 N2 O2 |
| Smiles: | CCOC(c1cnc2ccccc2c1Nc1cccc(C)c1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.5033 |
| logD: | 4.5033 |
| logSw: | -4.1052 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 37.361 |
| InChI Key: | SJPVRYWSSFXIQJ-UHFFFAOYSA-N |