4-(2,4-dichlorophenoxy)-N-(4-phenyl-1,3-thiazol-2-yl)butanamide
Chemical Structure Depiction of
4-(2,4-dichlorophenoxy)-N-(4-phenyl-1,3-thiazol-2-yl)butanamide
4-(2,4-dichlorophenoxy)-N-(4-phenyl-1,3-thiazol-2-yl)butanamide
Compound characteristics
| Compound ID: | 3643-3088 |
| Compound Name: | 4-(2,4-dichlorophenoxy)-N-(4-phenyl-1,3-thiazol-2-yl)butanamide |
| Molecular Weight: | 407.32 |
| Molecular Formula: | C19 H16 Cl2 N2 O2 S |
| Smiles: | C(CC(Nc1nc(cs1)c1ccccc1)=O)COc1ccc(cc1[Cl])[Cl] |
| Stereo: | ACHIRAL |
| logP: | 5.6483 |
| logD: | 5.6483 |
| logSw: | -5.8872 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 40.395 |
| InChI Key: | ZFPUMVYQEHUSAR-UHFFFAOYSA-N |