3-chloro-N-[3-(5,6-dimethyl-1,3-benzoxazol-2-yl)-4-hydroxyphenyl]-1-benzothiophene-2-carboxamide
Chemical Structure Depiction of
3-chloro-N-[3-(5,6-dimethyl-1,3-benzoxazol-2-yl)-4-hydroxyphenyl]-1-benzothiophene-2-carboxamide
3-chloro-N-[3-(5,6-dimethyl-1,3-benzoxazol-2-yl)-4-hydroxyphenyl]-1-benzothiophene-2-carboxamide
Compound characteristics
| Compound ID: | 3646-2951 |
| Compound Name: | 3-chloro-N-[3-(5,6-dimethyl-1,3-benzoxazol-2-yl)-4-hydroxyphenyl]-1-benzothiophene-2-carboxamide |
| Molecular Weight: | 448.93 |
| Molecular Formula: | C24 H17 Cl N2 O3 S |
| Smiles: | Cc1cc2c(cc1C)oc(c1cc(ccc1O)NC(c1c(c3ccccc3s1)[Cl])=O)n2 |
| Stereo: | ACHIRAL |
| logP: | 7.4042 |
| logD: | 7.4039 |
| logSw: | -6.0462 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 57.435 |
| InChI Key: | URACCCURZBPSGE-UHFFFAOYSA-N |