2-{3-[(2-fluorophenoxy)methyl]-4-methoxyphenyl}-3-propyl-2,3-dihydroquinazolin-4(1H)-one
Chemical Structure Depiction of
2-{3-[(2-fluorophenoxy)methyl]-4-methoxyphenyl}-3-propyl-2,3-dihydroquinazolin-4(1H)-one
2-{3-[(2-fluorophenoxy)methyl]-4-methoxyphenyl}-3-propyl-2,3-dihydroquinazolin-4(1H)-one
Compound characteristics
| Compound ID: | 3647-0034 |
| Compound Name: | 2-{3-[(2-fluorophenoxy)methyl]-4-methoxyphenyl}-3-propyl-2,3-dihydroquinazolin-4(1H)-one |
| Molecular Weight: | 420.48 |
| Molecular Formula: | C25 H25 F N2 O3 |
| Smiles: | CCCN1C(c2ccc(c(COc3ccccc3F)c2)OC)Nc2ccccc2C1=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.1154 |
| logD: | 5.1154 |
| logSw: | -4.9407 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 42.537 |
| InChI Key: | RCHBGHKZZVTGEK-DEOSSOPVSA-N |