2-(4-bromophenyl)-3-{[(4-butoxyphenyl)methyl]amino}quinazolin-4(3H)-one
Chemical Structure Depiction of
2-(4-bromophenyl)-3-{[(4-butoxyphenyl)methyl]amino}quinazolin-4(3H)-one
2-(4-bromophenyl)-3-{[(4-butoxyphenyl)methyl]amino}quinazolin-4(3H)-one
Compound characteristics
| Compound ID: | 3651-6043 |
| Compound Name: | 2-(4-bromophenyl)-3-{[(4-butoxyphenyl)methyl]amino}quinazolin-4(3H)-one |
| Molecular Weight: | 478.39 |
| Molecular Formula: | C25 H24 Br N3 O2 |
| Smiles: | CCCCOc1ccc(CNN2C(c3ccc(cc3)[Br])=Nc3ccccc3C2=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 5.3391 |
| logD: | 5.3391 |
| logSw: | -5.3116 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 46.294 |
| InChI Key: | IPQBEWZMDBDSGC-UHFFFAOYSA-N |