2-(4-butylphenyl)-3-{[(2-chloro-6-fluorophenyl)methyl]amino}quinazolin-4(3H)-one
Chemical Structure Depiction of
2-(4-butylphenyl)-3-{[(2-chloro-6-fluorophenyl)methyl]amino}quinazolin-4(3H)-one
2-(4-butylphenyl)-3-{[(2-chloro-6-fluorophenyl)methyl]amino}quinazolin-4(3H)-one
Compound characteristics
| Compound ID: | 3651-6212 |
| Compound Name: | 2-(4-butylphenyl)-3-{[(2-chloro-6-fluorophenyl)methyl]amino}quinazolin-4(3H)-one |
| Molecular Weight: | 435.93 |
| Molecular Formula: | C25 H23 Cl F N3 O |
| Smiles: | CCCCc1ccc(cc1)C1=Nc2ccccc2C(N1NCc1c(cccc1[Cl])F)=O |
| Stereo: | ACHIRAL |
| logP: | 5.8175 |
| logD: | 5.8174 |
| logSw: | -5.7699 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 38.876 |
| InChI Key: | UYVBTLNDAKEUKY-UHFFFAOYSA-N |