N~4~-ethyl-N~6~-(2-methoxyphenyl)-7-nitro-2,1,3-benzoxadiazole-4,6-diamine
Chemical Structure Depiction of
N~4~-ethyl-N~6~-(2-methoxyphenyl)-7-nitro-2,1,3-benzoxadiazole-4,6-diamine
N~4~-ethyl-N~6~-(2-methoxyphenyl)-7-nitro-2,1,3-benzoxadiazole-4,6-diamine
Compound characteristics
| Compound ID: | 3660-0487 |
| Compound Name: | N~4~-ethyl-N~6~-(2-methoxyphenyl)-7-nitro-2,1,3-benzoxadiazole-4,6-diamine |
| Molecular Weight: | 329.31 |
| Molecular Formula: | C15 H15 N5 O4 |
| Smiles: | CCNc1cc(c(c2c1non2)[N+]([O-])=O)Nc1ccccc1OC |
| Stereo: | ACHIRAL |
| logP: | 4.0615 |
| logD: | 4.0615 |
| logSw: | -4.2971 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 94.46 |
| InChI Key: | JKHIMDOLVSIADJ-UHFFFAOYSA-N |