ethyl 2-[(4-fluorophenyl)methylidene]-3-oxo-5,7-diphenyl-2,3-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate
Chemical Structure Depiction of
ethyl 2-[(4-fluorophenyl)methylidene]-3-oxo-5,7-diphenyl-2,3-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate
ethyl 2-[(4-fluorophenyl)methylidene]-3-oxo-5,7-diphenyl-2,3-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate
Compound characteristics
| Compound ID: | 3667-0614 |
| Compound Name: | ethyl 2-[(4-fluorophenyl)methylidene]-3-oxo-5,7-diphenyl-2,3-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| Molecular Weight: | 484.55 |
| Molecular Formula: | C28 H21 F N2 O3 S |
| Smiles: | CCOC(C1C(c2ccccc2)N2C(=NC=1c1ccccc1)SC(=C/c1ccc(cc1)F)\C2=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.1631 |
| logD: | 6.1631 |
| logSw: | -5.6391 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 45.977 |
| InChI Key: | DGKFSKZWEWQGEO-RUZDIDTESA-N |