1-(2-ethylphenyl)-5-{[5-(4-fluorophenyl)furan-2-yl]methylidene}-2-sulfanylidene-1,3-diazinane-4,6-dione
Chemical Structure Depiction of
1-(2-ethylphenyl)-5-{[5-(4-fluorophenyl)furan-2-yl]methylidene}-2-sulfanylidene-1,3-diazinane-4,6-dione
1-(2-ethylphenyl)-5-{[5-(4-fluorophenyl)furan-2-yl]methylidene}-2-sulfanylidene-1,3-diazinane-4,6-dione
Compound characteristics
| Compound ID: | 3679-1168 |
| Compound Name: | 1-(2-ethylphenyl)-5-{[5-(4-fluorophenyl)furan-2-yl]methylidene}-2-sulfanylidene-1,3-diazinane-4,6-dione |
| Molecular Weight: | 420.46 |
| Molecular Formula: | C23 H17 F N2 O3 S |
| Smiles: | CCc1ccccc1N1C(C(=C\c2ccc(c3ccc(cc3)F)o2)\C(NC1=S)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.8352 |
| logD: | 4.061 |
| logSw: | -4.5512 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.497 |
| InChI Key: | HRNVRYHTEGTSSJ-UHFFFAOYSA-N |