3-[5-(4-chlorophenyl)furan-2-yl]-2-cyano-N-(2-methyl-5-nitrophenyl)prop-2-enamide
Chemical Structure Depiction of
3-[5-(4-chlorophenyl)furan-2-yl]-2-cyano-N-(2-methyl-5-nitrophenyl)prop-2-enamide
3-[5-(4-chlorophenyl)furan-2-yl]-2-cyano-N-(2-methyl-5-nitrophenyl)prop-2-enamide
Compound characteristics
| Compound ID: | 3681-3507 |
| Compound Name: | 3-[5-(4-chlorophenyl)furan-2-yl]-2-cyano-N-(2-methyl-5-nitrophenyl)prop-2-enamide |
| Molecular Weight: | 407.81 |
| Molecular Formula: | C21 H14 Cl N3 O4 |
| Smiles: | Cc1ccc(cc1NC(C(=C\c1ccc(c2ccc(cc2)[Cl])o1)\C#N)=O)[N+]([O-])=O |
| Stereo: | ACHIRAL |
| logP: | 5.326 |
| logD: | 4.8211 |
| logSw: | -6.0274 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 80.639 |
| InChI Key: | YIJZTUNGKHFMTQ-UHFFFAOYSA-N |