1-(4-bromophenyl)-5-[(2,4-dimethoxy-5-nitrophenyl)methylidene]-1,3-diazinane-2,4,6-trione
					Chemical Structure Depiction of
1-(4-bromophenyl)-5-[(2,4-dimethoxy-5-nitrophenyl)methylidene]-1,3-diazinane-2,4,6-trione
			1-(4-bromophenyl)-5-[(2,4-dimethoxy-5-nitrophenyl)methylidene]-1,3-diazinane-2,4,6-trione
Compound characteristics
| Compound ID: | 3684-2462 | 
| Compound Name: | 1-(4-bromophenyl)-5-[(2,4-dimethoxy-5-nitrophenyl)methylidene]-1,3-diazinane-2,4,6-trione | 
| Molecular Weight: | 476.24 | 
| Molecular Formula: | C19 H14 Br N3 O7 | 
| Smiles: | COc1cc(c(cc1\C=C1/C(NC(N(C1=O)c1ccc(cc1)[Br])=O)=O)[N+]([O-])=O)OC | 
| Stereo: | ACHIRAL | 
| logP: | 3.1043 | 
| logD: | 2.9278 | 
| logSw: | -3.5893 | 
| Hydrogen bond acceptors count: | 12 | 
| Hydrogen bond donors count: | 1 | 
| Polar surface area: | 101.732 | 
| InChI Key: | GCQXWUMOMUZAPF-UHFFFAOYSA-N | 
 
				 
				