1-(4-bromophenyl)-5-[(2,4-dimethoxy-5-nitrophenyl)methylidene]-1,3-diazinane-2,4,6-trione
Chemical Structure Depiction of
1-(4-bromophenyl)-5-[(2,4-dimethoxy-5-nitrophenyl)methylidene]-1,3-diazinane-2,4,6-trione
1-(4-bromophenyl)-5-[(2,4-dimethoxy-5-nitrophenyl)methylidene]-1,3-diazinane-2,4,6-trione
Compound characteristics
| Compound ID: | 3684-2462 |
| Compound Name: | 1-(4-bromophenyl)-5-[(2,4-dimethoxy-5-nitrophenyl)methylidene]-1,3-diazinane-2,4,6-trione |
| Molecular Weight: | 476.24 |
| Molecular Formula: | C19 H14 Br N3 O7 |
| Smiles: | COc1cc(c(cc1\C=C1/C(NC(N(C1=O)c1ccc(cc1)[Br])=O)=O)[N+]([O-])=O)OC |
| Stereo: | ACHIRAL |
| logP: | 3.1043 |
| logD: | 2.9278 |
| logSw: | -3.5893 |
| Hydrogen bond acceptors count: | 12 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 101.732 |
| InChI Key: | GCQXWUMOMUZAPF-UHFFFAOYSA-N |