N-(4-sulfamoylphenyl)-2-[(5H-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]butanamide
Chemical Structure Depiction of
N-(4-sulfamoylphenyl)-2-[(5H-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]butanamide
N-(4-sulfamoylphenyl)-2-[(5H-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]butanamide
Compound characteristics
| Compound ID: | 3698-0006 |
| Compound Name: | N-(4-sulfamoylphenyl)-2-[(5H-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]butanamide |
| Molecular Weight: | 442.52 |
| Molecular Formula: | C19 H18 N6 O3 S2 |
| Smiles: | CCC(C(Nc1ccc(cc1)S(N)(=O)=O)=O)Sc1nc2c(c3ccccc3[nH]2)nn1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.0091 |
| logD: | 2.0078 |
| logSw: | -2.6485 |
| Hydrogen bond acceptors count: | 11 |
| Hydrogen bond donors count: | 4 |
| Polar surface area: | 115.5 |
| InChI Key: | XBGFWXZSCFNXAA-HNNXBMFYSA-N |