(2-methoxyphenyl){4-[(4-nitrophenyl)methyl]piperazin-1-yl}methanone
Chemical Structure Depiction of
(2-methoxyphenyl){4-[(4-nitrophenyl)methyl]piperazin-1-yl}methanone
(2-methoxyphenyl){4-[(4-nitrophenyl)methyl]piperazin-1-yl}methanone
Compound characteristics
| Compound ID: | 3701-0303 |
| Compound Name: | (2-methoxyphenyl){4-[(4-nitrophenyl)methyl]piperazin-1-yl}methanone |
| Molecular Weight: | 355.39 |
| Molecular Formula: | C19 H21 N3 O4 |
| Smiles: | COc1ccccc1C(N1CCN(CC1)Cc1ccc(cc1)[N+]([O-])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.2267 |
| logD: | 2.2159 |
| logSw: | -2.7721 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 61.439 |
| InChI Key: | AXRVKIGBKOINMK-UHFFFAOYSA-N |