{4-[(2,4-dimethoxyphenyl)methyl]piperazin-1-yl}(3,4,5-trimethoxyphenyl)methanone--oxalic acid (1/1)
Chemical Structure Depiction of
{4-[(2,4-dimethoxyphenyl)methyl]piperazin-1-yl}(3,4,5-trimethoxyphenyl)methanone--oxalic acid (1/1)
{4-[(2,4-dimethoxyphenyl)methyl]piperazin-1-yl}(3,4,5-trimethoxyphenyl)methanone--oxalic acid (1/1)
Compound characteristics
| Compound ID: | 3702-0367 |
| Compound Name: | {4-[(2,4-dimethoxyphenyl)methyl]piperazin-1-yl}(3,4,5-trimethoxyphenyl)methanone--oxalic acid (1/1) |
| Molecular Weight: | 520.54 |
| Molecular Formula: | C23 H30 N2 O6 |
| Salt: | HOOCCOOH |
| Smiles: | COc1ccc(CN2CCN(CC2)C(c2cc(c(c(c2)OC)OC)OC)=O)c(c1)OC |
| Stereo: | ACHIRAL |
| logP: | 2.2377 |
| logD: | 2.2287 |
| logSw: | -2.8801 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 58.579 |
| InChI Key: | AXUIWFRDZVECQV-UHFFFAOYSA-N |