(2-chloro-4-{[1-(3-fluorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl}phenoxy)acetic acid
Chemical Structure Depiction of
(2-chloro-4-{[1-(3-fluorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl}phenoxy)acetic acid
(2-chloro-4-{[1-(3-fluorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl}phenoxy)acetic acid
Compound characteristics
| Compound ID: | 3703-0274 |
| Compound Name: | (2-chloro-4-{[1-(3-fluorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl}phenoxy)acetic acid |
| Molecular Weight: | 418.76 |
| Molecular Formula: | C19 H12 Cl F N2 O6 |
| Smiles: | C(C(O)=O)Oc1ccc(\C=C2/C(NC(N(C2=O)c2cccc(c2)F)=O)=O)cc1[Cl] |
| Stereo: | ACHIRAL |
| logP: | 2.2951 |
| logD: | -1.9419 |
| logSw: | -3.3072 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 89.36 |
| InChI Key: | BXHBXGLJMWLQKW-UHFFFAOYSA-N |