N-[2-(3-chloro-4-methylphenyl)-2H-benzotriazol-5-yl]furan-2-carboxamide
Chemical Structure Depiction of
N-[2-(3-chloro-4-methylphenyl)-2H-benzotriazol-5-yl]furan-2-carboxamide
N-[2-(3-chloro-4-methylphenyl)-2H-benzotriazol-5-yl]furan-2-carboxamide
Compound characteristics
| Compound ID: | 3729-2677 |
| Compound Name: | N-[2-(3-chloro-4-methylphenyl)-2H-benzotriazol-5-yl]furan-2-carboxamide |
| Molecular Weight: | 352.78 |
| Molecular Formula: | C18 H13 Cl N4 O2 |
| Smiles: | Cc1ccc(cc1[Cl])n1nc2ccc(cc2n1)NC(c1ccco1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.7919 |
| logD: | 4.7866 |
| logSw: | -4.9026 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 55.942 |
| InChI Key: | WPUXOAURQSLPPY-UHFFFAOYSA-N |