5-(2-chloro-7-methylquinolin-3-yl)-N-methyl-3-phenyl-4,5-dihydro-1H-pyrazole-1-carbothioamide
Chemical Structure Depiction of
5-(2-chloro-7-methylquinolin-3-yl)-N-methyl-3-phenyl-4,5-dihydro-1H-pyrazole-1-carbothioamide
5-(2-chloro-7-methylquinolin-3-yl)-N-methyl-3-phenyl-4,5-dihydro-1H-pyrazole-1-carbothioamide
Compound characteristics
| Compound ID: | 3740-0895 |
| Compound Name: | 5-(2-chloro-7-methylquinolin-3-yl)-N-methyl-3-phenyl-4,5-dihydro-1H-pyrazole-1-carbothioamide |
| Molecular Weight: | 394.92 |
| Molecular Formula: | C21 H19 Cl N4 S |
| Smiles: | Cc1ccc2cc(C3CC(c4ccccc4)=NN3C(NC)=S)c(nc2c1)[Cl] |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.3411 |
| logD: | 5.3411 |
| logSw: | -6.1099 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 32.077 |
| InChI Key: | CUGSARRVUNPDQR-IBGZPJMESA-N |