5-(4-methylphenyl)-N-phenyl-3-(thiophen-2-yl)-4,5-dihydro-1H-pyrazole-1-carbothioamide
Chemical Structure Depiction of
5-(4-methylphenyl)-N-phenyl-3-(thiophen-2-yl)-4,5-dihydro-1H-pyrazole-1-carbothioamide
5-(4-methylphenyl)-N-phenyl-3-(thiophen-2-yl)-4,5-dihydro-1H-pyrazole-1-carbothioamide
Compound characteristics
| Compound ID: | 3740-0974 |
| Compound Name: | 5-(4-methylphenyl)-N-phenyl-3-(thiophen-2-yl)-4,5-dihydro-1H-pyrazole-1-carbothioamide |
| Molecular Weight: | 377.53 |
| Molecular Formula: | C21 H19 N3 S2 |
| Smiles: | Cc1ccc(cc1)C1CC(c2cccs2)=NN1C(Nc1ccccc1)=S |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.9627 |
| logD: | 5.9627 |
| logSw: | -5.7962 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 22.3829 |
| InChI Key: | PFKRJFUEFDYXBN-IBGZPJMESA-N |